C17H16O — CID 71398353
1-benzyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 71398353) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-benzyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 1-benzyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 71398353 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-benzyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | c1ccc(CC23CCC(O2)c2ccccc23)cc1 |
| InChI | InChI=1S/C17H16O/c1-2-6-13(7-3-1)12-17-11-10-16(18-17)14-8-4-5-9-15(14)17/h1-9,16H,10-12H2 |
| InChIKey | BWUWHKBTRZTFJF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |