About 2-methyl-1H-phenalene
2-methyl-1H-phenalene (PubChem CID 71398400) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyl-1H-phenalene.
Molecular Properties
| Compound Name | 2-methyl-1H-phenalene |
| PubChem CID | 71398400 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-methyl-1H-phenalene |
| SMILES | CC1=Cc2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C14H12/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h2-8H,9H2,1H3 |
| InChIKey | IFARIKUOUNGMRB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-phenalene?
The IUPAC name of 2-methyl-1H-phenalene (CID 71398400) is 2-methyl-1H-phenalene.
What is the SMILES notation for 2-methyl-1H-phenalene?
The canonical SMILES for 2-methyl-1H-phenalene is CC1=Cc2cccc3cccc(c23)C1.
What is the InChIKey of 2-methyl-1H-phenalene?
The InChIKey is IFARIKUOUNGMRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h2-8H,9H2,1H3.
What are the key properties of 2-methyl-1H-phenalene?
2-methyl-1H-phenalene has a molecular weight of 180.25 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-phenalene is sourced from PubChem (CID 71398400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).