About 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one
2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one (PubChem CID 71398484) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one.
Analyze 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one?
The IUPAC name of 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one (CID 71398484) is 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one.
What is the SMILES notation for 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one?
The canonical SMILES for 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one is CC1=C2CC(C)(C)CC2(C)CCC1=O.
What is the InChIKey of 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one?
The InChIKey is BDESRPSLQVAQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-9-10-7-12(2,3)8-13(10,4)6-5-11(9)14/h5-8H2,1-4H3.
What are the key properties of 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one?
2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one has a molecular weight of 192.30 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4,7a-tetramethyl-1,3,6,7-tetrahydroinden-5-one is sourced from PubChem (CID 71398484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).