About 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide
3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide (PubChem CID 71398593) has the molecular formula C13H8F3NO2S
and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide |
| PubChem CID | 71398593 |
| Molecular Formula | C13H8F3NO2S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H8F3NO2S/c14-13(15,16)8-5-6-10-12(7-8)20(18,19)11-4-2-1-3-9(11)17-10/h1-7,17H |
| InChIKey | HDKWQTPDCMCPOD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide?
The IUPAC name of 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide (CID 71398593) is 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide.
What is the SMILES notation for 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide?
The canonical SMILES for 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide is O=S1(=O)c2ccccc2Nc2ccc(C(F)(F)F)cc21.
What is the InChIKey of 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide?
The InChIKey is HDKWQTPDCMCPOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3NO2S/c14-13(15,16)8-5-6-10-12(7-8)20(18,19)11-4-2-1-3-9(11)17-10/h1-7,17H.
What are the key properties of 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide?
3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide has a molecular weight of 299.27 g/mol, XLogP of 3.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-10H-phenothiazine 5,5-dioxide is sourced from PubChem (CID 71398593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).