About 2-azido-4,5-diphenylpyridine-3-carbonitrile
2-azido-4,5-diphenylpyridine-3-carbonitrile (PubChem CID 71400013) has the molecular formula C18H11N5
and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-azido-4,5-diphenylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-azido-4,5-diphenylpyridine-3-carbonitrile |
| PubChem CID | 71400013 |
| Molecular Formula | C18H11N5 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-azido-4,5-diphenylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(N=[N+]=[N-])ncc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H11N5/c19-11-15-17(14-9-5-2-6-10-14)16(12-21-18(15)22-23-20)13-7-3-1-4-8-13/h1-10,12H |
| InChIKey | KRNSUQAPHUXJLN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-4,5-diphenylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-4,5-diphenylpyridine-3-carbonitrile?
The IUPAC name of 2-azido-4,5-diphenylpyridine-3-carbonitrile (CID 71400013) is 2-azido-4,5-diphenylpyridine-3-carbonitrile.
What is the SMILES notation for 2-azido-4,5-diphenylpyridine-3-carbonitrile?
The canonical SMILES for 2-azido-4,5-diphenylpyridine-3-carbonitrile is N#Cc1c(N=[N+]=[N-])ncc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-azido-4,5-diphenylpyridine-3-carbonitrile?
The InChIKey is KRNSUQAPHUXJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N5/c19-11-15-17(14-9-5-2-6-10-14)16(12-21-18(15)22-23-20)13-7-3-1-4-8-13/h1-10,12H.
What are the key properties of 2-azido-4,5-diphenylpyridine-3-carbonitrile?
2-azido-4,5-diphenylpyridine-3-carbonitrile has a molecular weight of 297.32 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-4,5-diphenylpyridine-3-carbonitrile is sourced from PubChem (CID 71400013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).