cyclonon-2-en-1-ol;nitric acid

C9H17NO4 — CID 71400030

IUPACcyclonon-2-en-1-ol;nitric acid
SMILESO=[N+]([O-])O.OC1C=CCCCCCC1
InChIInChI=1S/C9H16O.HNO3/c10-9-7-5-3-1-2-4-6-8-9;2-1(3)4/h5,7,9-10H,1-4,6,8H2;(H,2,3,4)
InChIKeyURUORTPAOJLVQE-UHFFFAOYSA-N
MW203.24 g/mol
LogP1.91
Rot. Bonds

About cyclonon-2-en-1-ol;nitric acid

cyclonon-2-en-1-ol;nitric acid (PubChem CID 71400030) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is cyclonon-2-en-1-ol;nitric acid.

Molecular Properties

Compound Namecyclonon-2-en-1-ol;nitric acid
PubChem CID71400030
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Namecyclonon-2-en-1-ol;nitric acid
SMILESO=[N+]([O-])O.OC1C=CCCCCCC1
InChIInChI=1S/C9H16O.HNO3/c10-9-7-5-3-1-2-4-6-8-9;2-1(3)4/h5,7,9-10H,1-4,6,8H2;(H,2,3,4)
InChIKeyURUORTPAOJLVQE-UHFFFAOYSA-N
XLogP1.91
TPSA83.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze cyclonon-2-en-1-ol;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclonon-2-en-1-ol;nitric acid?
The IUPAC name of cyclonon-2-en-1-ol;nitric acid (CID 71400030) is cyclonon-2-en-1-ol;nitric acid.
What is the SMILES notation for cyclonon-2-en-1-ol;nitric acid?
The canonical SMILES for cyclonon-2-en-1-ol;nitric acid is O=[N+]([O-])O.OC1C=CCCCCCC1.
What is the InChIKey of cyclonon-2-en-1-ol;nitric acid?
The InChIKey is URUORTPAOJLVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O.HNO3/c10-9-7-5-3-1-2-4-6-8-9;2-1(3)4/h5,7,9-10H,1-4,6,8H2;(H,2,3,4).
What are the key properties of cyclonon-2-en-1-ol;nitric acid?
cyclonon-2-en-1-ol;nitric acid has a molecular weight of 203.24 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclonon-2-en-1-ol;nitric acid is sourced from PubChem (CID 71400030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).