About CID 71400244
CID 71400244 (PubChem CID 71400244) has the molecular formula C17H20AsO
and a molecular weight of 315.27 g/mol.
Molecular Properties
| Compound Name | CID 71400244 |
| PubChem CID | 71400244 |
| Molecular Formula | C17H20AsO |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | — |
| SMILES | CC[As]1(C(C)C)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C17H20AsO/c1-4-18(13(2)3)14-9-5-7-11-16(14)19-17-12-8-6-10-15(17)18/h5-13H,4H2,1-3H3 |
| InChIKey | AWYVKTYVAMVMHR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71400244 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71400244?
The IUPAC name of CID 71400244 (CID 71400244) is not available.
What is the SMILES notation for CID 71400244?
The canonical SMILES for CID 71400244 is CC[As]1(C(C)C)c2ccccc2Oc2ccccc21.
What is the InChIKey of CID 71400244?
The InChIKey is AWYVKTYVAMVMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20AsO/c1-4-18(13(2)3)14-9-5-7-11-16(14)19-17-12-8-6-10-15(17)18/h5-13H,4H2,1-3H3.
What are the key properties of CID 71400244?
CID 71400244 has a molecular weight of 315.27 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71400244 is sourced from PubChem (CID 71400244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).