About 2,2,2-trichloroethyl 2-diazoacetate
2,2,2-trichloroethyl 2-diazoacetate (PubChem CID 71400363) has the molecular formula C4H3Cl3N2O2
and a molecular weight of 217.44 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-diazoacetate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl 2-diazoacetate |
| PubChem CID | 71400363 |
| Molecular Formula | C4H3Cl3N2O2 |
| Molecular Weight | 217.44 g/mol |
| Exact Mass | 215.93 |
| IUPAC Name | 2,2,2-trichloroethyl 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H3Cl3N2O2/c5-4(6,7)2-11-3(10)1-9-8/h1H,2H2 |
| InChIKey | UCEJHTUEWOGUEL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl 2-diazoacetate?
The IUPAC name of 2,2,2-trichloroethyl 2-diazoacetate (CID 71400363) is 2,2,2-trichloroethyl 2-diazoacetate.
What is the SMILES notation for 2,2,2-trichloroethyl 2-diazoacetate?
The canonical SMILES for 2,2,2-trichloroethyl 2-diazoacetate is [N-]=[N+]=CC(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroethyl 2-diazoacetate?
The InChIKey is UCEJHTUEWOGUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3Cl3N2O2/c5-4(6,7)2-11-3(10)1-9-8/h1H,2H2.
What are the key properties of 2,2,2-trichloroethyl 2-diazoacetate?
2,2,2-trichloroethyl 2-diazoacetate has a molecular weight of 217.44 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl 2-diazoacetate is sourced from PubChem (CID 71400363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).