About 2,8-dimethoxythianthrene
2,8-dimethoxythianthrene (PubChem CID 71400378) has the molecular formula C14H12O2S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,8-dimethoxythianthrene.
Molecular Properties
| Compound Name | 2,8-dimethoxythianthrene |
| PubChem CID | 71400378 |
| Molecular Formula | C14H12O2S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2,8-dimethoxythianthrene |
| SMILES | COc1ccc2c(c1)Sc1cc(OC)ccc1S2 |
| InChI | InChI=1S/C14H12O2S2/c1-15-9-3-5-11-13(7-9)18-14-8-10(16-2)4-6-12(14)17-11/h3-8H,1-2H3 |
| InChIKey | GMAZAHFEVMBCFU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,8-dimethoxythianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethoxythianthrene?
The IUPAC name of 2,8-dimethoxythianthrene (CID 71400378) is 2,8-dimethoxythianthrene.
What is the SMILES notation for 2,8-dimethoxythianthrene?
The canonical SMILES for 2,8-dimethoxythianthrene is COc1ccc2c(c1)Sc1cc(OC)ccc1S2.
What is the InChIKey of 2,8-dimethoxythianthrene?
The InChIKey is GMAZAHFEVMBCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S2/c1-15-9-3-5-11-13(7-9)18-14-8-10(16-2)4-6-12(14)17-11/h3-8H,1-2H3.
What are the key properties of 2,8-dimethoxythianthrene?
2,8-dimethoxythianthrene has a molecular weight of 276.38 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethoxythianthrene is sourced from PubChem (CID 71400378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).