C11H19N — CID 71400802
(3S,4aS)-3,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-quinoline (PubChem CID 71400802) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3S,4aS)-3,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-quinoline.
| Compound Name | (3S,4aS)-3,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 71400802 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3S,4aS)-3,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-quinoline |
| SMILES | C[C@@H]1CN=C2CCCC[C@@]2(C)C1 |
| InChI | InChI=1S/C11H19N/c1-9-7-11(2)6-4-3-5-10(11)12-8-9/h9H,3-8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | OVRFABQOXVAYPO-ONGXEEELSA-N |
| XLogP | 3.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |