About N',2-diamino-1,8-naphthyridine-3-carboximidamide
N',2-diamino-1,8-naphthyridine-3-carboximidamide (PubChem CID 71400819) has the molecular formula C9H10N6
and a molecular weight of 202.22 g/mol. Its IUPAC name is N',2-diamino-1,8-naphthyridine-3-carboximidamide.
Molecular Properties
| Compound Name | N',2-diamino-1,8-naphthyridine-3-carboximidamide |
| PubChem CID | 71400819 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | N',2-diamino-1,8-naphthyridine-3-carboximidamide |
| SMILES | NN=C(N)c1cc2cccnc2nc1N |
| InChI | InChI=1S/C9H10N6/c10-7-6(8(11)15-12)4-5-2-1-3-13-9(5)14-7/h1-4H,12H2,(H2,11,15)(H2,10,13,14) |
| InChIKey | PJUGICOVLHDBSO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',2-diamino-1,8-naphthyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-diamino-1,8-naphthyridine-3-carboximidamide?
The IUPAC name of N',2-diamino-1,8-naphthyridine-3-carboximidamide (CID 71400819) is N',2-diamino-1,8-naphthyridine-3-carboximidamide.
What is the SMILES notation for N',2-diamino-1,8-naphthyridine-3-carboximidamide?
The canonical SMILES for N',2-diamino-1,8-naphthyridine-3-carboximidamide is NN=C(N)c1cc2cccnc2nc1N.
What is the InChIKey of N',2-diamino-1,8-naphthyridine-3-carboximidamide?
The InChIKey is PJUGICOVLHDBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6/c10-7-6(8(11)15-12)4-5-2-1-3-13-9(5)14-7/h1-4H,12H2,(H2,11,15)(H2,10,13,14).
What are the key properties of N',2-diamino-1,8-naphthyridine-3-carboximidamide?
N',2-diamino-1,8-naphthyridine-3-carboximidamide has a molecular weight of 202.22 g/mol, XLogP of -0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-diamino-1,8-naphthyridine-3-carboximidamide is sourced from PubChem (CID 71400819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).