C19H33NO2 — CID 71400852
N,N-diethyl-3,7-dimethyl-9-(oxolan-2-yl)nona-2,6-dienamide (PubChem CID 71400852) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is N,N-diethyl-3,7-dimethyl-9-(oxolan-2-yl)nona-2,6-dienamide.
| Compound Name | N,N-diethyl-3,7-dimethyl-9-(oxolan-2-yl)nona-2,6-dienamide |
|---|---|
| PubChem CID | 71400852 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | N,N-diethyl-3,7-dimethyl-9-(oxolan-2-yl)nona-2,6-dienamide |
| SMILES | CCN(CC)C(=O)C=C(C)CCC=C(C)CCC1CCCO1 |
| InChI | InChI=1S/C19H33NO2/c1-5-20(6-2)19(21)15-17(4)10-7-9-16(3)12-13-18-11-8-14-22-18/h9,15,18H,5-8,10-14H2,1-4H3 |
| InChIKey | HWMBBPXNXAVVBE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|