About 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride
4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride (PubChem CID 71400890) has the molecular formula C17H22ClNO
and a molecular weight of 291.82 g/mol. Its IUPAC name is 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride.
Molecular Properties
| Compound Name | 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride |
| PubChem CID | 71400890 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride |
| SMILES | Cl.O=C1CC2C3CCN(CC3)C2CC1c1ccccc1 |
| InChI | InChI=1S/C17H21NO.ClH/c19-17-11-14-13-6-8-18(9-7-13)16(14)10-15(17)12-4-2-1-3-5-12;/h1-5,13-16H,6-11H2;1H |
| InChIKey | FCRMRZRBCAEBDB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride?
The IUPAC name of 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride (CID 71400890) is 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride.
What is the SMILES notation for 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride?
The canonical SMILES for 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride is Cl.O=C1CC2C3CCN(CC3)C2CC1c1ccccc1.
What is the InChIKey of 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride?
The InChIKey is FCRMRZRBCAEBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO.ClH/c19-17-11-14-13-6-8-18(9-7-13)16(14)10-15(17)12-4-2-1-3-5-12;/h1-5,13-16H,6-11H2;1H.
What are the key properties of 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride?
4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride has a molecular weight of 291.82 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-azatricyclo[6.2.2.02,7]dodecan-5-one;hydrochloride is sourced from PubChem (CID 71400890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).