About diethyl 2-acetyloxybutanedioate
diethyl 2-acetyloxybutanedioate (PubChem CID 71401904) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is diethyl 2-acetyloxybutanedioate.
Molecular Properties
| Compound Name | diethyl 2-acetyloxybutanedioate |
| PubChem CID | 71401904 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | diethyl 2-acetyloxybutanedioate |
| SMILES | CCOC(=O)CC(OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C10H16O6/c1-4-14-9(12)6-8(16-7(3)11)10(13)15-5-2/h8H,4-6H2,1-3H3 |
| InChIKey | SRMBTWGTHRLBLX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetyloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetyloxybutanedioate?
The IUPAC name of diethyl 2-acetyloxybutanedioate (CID 71401904) is diethyl 2-acetyloxybutanedioate.
What is the SMILES notation for diethyl 2-acetyloxybutanedioate?
The canonical SMILES for diethyl 2-acetyloxybutanedioate is CCOC(=O)CC(OC(C)=O)C(=O)OCC.
What is the InChIKey of diethyl 2-acetyloxybutanedioate?
The InChIKey is SRMBTWGTHRLBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6/c1-4-14-9(12)6-8(16-7(3)11)10(13)15-5-2/h8H,4-6H2,1-3H3.
What are the key properties of diethyl 2-acetyloxybutanedioate?
diethyl 2-acetyloxybutanedioate has a molecular weight of 232.23 g/mol, XLogP of 0.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetyloxybutanedioate is sourced from PubChem (CID 71401904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).