C10H13BrO2 — CID 7140209
(1S,4S)-1-bromo-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 7140209) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is (1S,4S)-1-bromo-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | (1S,4S)-1-bromo-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 7140209 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (1S,4S)-1-bromo-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC1(C)[C@@]2(Br)CC[C@]1(C)C(=O)C2=O |
| InChI | InChI=1S/C10H13BrO2/c1-8(2)9(3)4-5-10(8,11)7(13)6(9)12/h4-5H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | XWHPNMXMTPPGKT-NXEZZACHSA-N |
| XLogP | 2.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|