About N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine
N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine (PubChem CID 71402411) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 71402411 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCNCC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C11H22N2O2/c12-6-7-13-8-10-9-14-11(15-10)4-2-1-3-5-11/h10,13H,1-9,12H2 |
| InChIKey | MZARSXQNGCMWSU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine (CID 71402411) is N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine is NCCNCC1COC2(CCCCC2)O1.
What is the InChIKey of N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine?
The InChIKey is MZARSXQNGCMWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c12-6-7-13-8-10-9-14-11(15-10)4-2-1-3-5-11/h10,13H,1-9,12H2.
What are the key properties of N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine?
N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine has a molecular weight of 214.31 g/mol, XLogP of 0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 71402411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).