C19H28I2O7 — CID 71402775
2,4-bis[2-[2-(2-iodoethoxy)ethoxy]ethoxy]benzaldehyde (PubChem CID 71402775) has the molecular formula C19H28I2O7 and a molecular weight of 622.23 g/mol. Its IUPAC name is 2,4-bis[2-[2-(2-iodoethoxy)ethoxy]ethoxy]benzaldehyde.
| Compound Name | 2,4-bis[2-[2-(2-iodoethoxy)ethoxy]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 71402775 |
| Molecular Formula | C19H28I2O7 |
| Molecular Weight | 622.23 g/mol |
| Exact Mass | 621.99 |
| IUPAC Name | 2,4-bis[2-[2-(2-iodoethoxy)ethoxy]ethoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCCOCCOCCI)cc1OCCOCCOCCI |
| InChI | InChI=1S/C19H28I2O7/c20-3-5-23-7-9-25-11-13-27-18-2-1-17(16-22)19(15-18)28-14-12-26-10-8-24-6-4-21/h1-2,15-16H,3-14H2 |
| InChIKey | AMBCZNMWLHMZHY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|