About (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol
(1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol (PubChem CID 71402876) has the molecular formula C7H12O2S
and a molecular weight of 160.24 g/mol. Its IUPAC name is (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol.
Molecular Properties
| Compound Name | (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol |
| PubChem CID | 71402876 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol |
| SMILES | CSC1=CCC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O2S/c1-10-6-4-2-3-5(8)7(6)9/h4-5,7-9H,2-3H2,1H3/t5-,7-/m0/s1 |
| InChIKey | RRAUCJHHJIEYIY-FSPLSTOPSA-N |
| XLogP | 0.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol?
The IUPAC name of (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol (CID 71402876) is (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol.
What is the SMILES notation for (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol?
The canonical SMILES for (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol is CSC1=CCC[C@H](O)[C@@H]1O.
What is the InChIKey of (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol?
The InChIKey is RRAUCJHHJIEYIY-FSPLSTOPSA-N. The full InChI is InChI=1S/C7H12O2S/c1-10-6-4-2-3-5(8)7(6)9/h4-5,7-9H,2-3H2,1H3/t5-,7-/m0/s1.
What are the key properties of (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol?
(1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol has a molecular weight of 160.24 g/mol, XLogP of 0.75, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-3-methylsulfanylcyclohex-3-ene-1,2-diol is sourced from PubChem (CID 71402876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).