About 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid
2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid (PubChem CID 7140308) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid |
| PubChem CID | 7140308 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid |
| SMILES | C=C1CC[C@@H](CC(=O)O)[C@]1(C)CO |
| InChI | InChI=1S/C10H16O3/c1-7-3-4-8(5-9(12)13)10(7,2)6-11/h8,11H,1,3-6H2,2H3,(H,12,13)/t8-,10+/m0/s1 |
| InChIKey | CTRBZPDKCZGWRB-WCBMZHEXSA-N |
| XLogP | 1.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid?
The IUPAC name of 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid (CID 7140308) is 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid.
What is the SMILES notation for 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid?
The canonical SMILES for 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid is C=C1CC[C@@H](CC(=O)O)[C@]1(C)CO.
What is the InChIKey of 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid?
The InChIKey is CTRBZPDKCZGWRB-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H16O3/c1-7-3-4-8(5-9(12)13)10(7,2)6-11/h8,11H,1,3-6H2,2H3,(H,12,13)/t8-,10+/m0/s1.
What are the key properties of 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid?
2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid has a molecular weight of 184.23 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S)-2-(hydroxymethyl)-2-methyl-3-methylidenecyclopentyl]acetic acid is sourced from PubChem (CID 7140308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).