About 5,8-dibutyldodec-6-yne-5,8-diol
5,8-dibutyldodec-6-yne-5,8-diol (PubChem CID 71403309) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is 5,8-dibutyldodec-6-yne-5,8-diol.
Molecular Properties
| Compound Name | 5,8-dibutyldodec-6-yne-5,8-diol |
| PubChem CID | 71403309 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 5,8-dibutyldodec-6-yne-5,8-diol |
| SMILES | CCCCC(O)(C#CC(O)(CCCC)CCCC)CCCC |
| InChI | InChI=1S/C20H38O2/c1-5-9-13-19(21,14-10-6-2)17-18-20(22,15-11-7-3)16-12-8-4/h21-22H,5-16H2,1-4H3 |
| InChIKey | NQPIYCWZCGBTAU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dibutyldodec-6-yne-5,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dibutyldodec-6-yne-5,8-diol?
The IUPAC name of 5,8-dibutyldodec-6-yne-5,8-diol (CID 71403309) is 5,8-dibutyldodec-6-yne-5,8-diol.
What is the SMILES notation for 5,8-dibutyldodec-6-yne-5,8-diol?
The canonical SMILES for 5,8-dibutyldodec-6-yne-5,8-diol is CCCCC(O)(C#CC(O)(CCCC)CCCC)CCCC.
What is the InChIKey of 5,8-dibutyldodec-6-yne-5,8-diol?
The InChIKey is NQPIYCWZCGBTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-5-9-13-19(21,14-10-6-2)17-18-20(22,15-11-7-3)16-12-8-4/h21-22H,5-16H2,1-4H3.
What are the key properties of 5,8-dibutyldodec-6-yne-5,8-diol?
5,8-dibutyldodec-6-yne-5,8-diol has a molecular weight of 310.52 g/mol, XLogP of 5.21, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dibutyldodec-6-yne-5,8-diol is sourced from PubChem (CID 71403309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).