C7H7F9O3S — CID 71403600
3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)propan-1-ol (PubChem CID 71403600) has the molecular formula C7H7F9O3S and a molecular weight of 342.18 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)propan-1-ol.
| Compound Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 71403600 |
| Molecular Formula | C7H7F9O3S |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)propan-1-ol |
| SMILES | O=S(=O)(CCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9O3S/c8-4(9,6(12,13)14)5(10,11)7(15,16)20(18,19)3-1-2-17/h17H,1-3H2 |
| InChIKey | JKKPDZOHRMMNDN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|