About 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene
5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene (PubChem CID 71403720) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene |
| PubChem CID | 71403720 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene |
| SMILES | C1=CC(C=CC2C=CC=C2)C=C1 |
| InChI | InChI=1S/C12H12/c1-2-6-11(5-1)9-10-12-7-3-4-8-12/h1-12H |
| InChIKey | HQVLRGPDFITVJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene?
The IUPAC name of 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene (CID 71403720) is 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene.
What is the SMILES notation for 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene?
The canonical SMILES for 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene is C1=CC(C=CC2C=CC=C2)C=C1.
What is the InChIKey of 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene?
The InChIKey is HQVLRGPDFITVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12/c1-2-6-11(5-1)9-10-12-7-3-4-8-12/h1-12H.
What are the key properties of 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene?
5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene has a molecular weight of 156.23 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclopenta-2,4-dien-1-ylethenyl)cyclopenta-1,3-diene is sourced from PubChem (CID 71403720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).