C19H26N2O5S — CID 7140391
(3S,5R,8S)-3-methyl-8-(2-methylpropoxymethyl)-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione (PubChem CID 7140391) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is (3S,5R,8S)-3-methyl-8-(2-methylpropoxymethyl)-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione.
| Compound Name | (3S,5R,8S)-3-methyl-8-(2-methylpropoxymethyl)-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione |
|---|---|
| PubChem CID | 7140391 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (3S,5R,8S)-3-methyl-8-(2-methylpropoxymethyl)-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]-2,7-dioxaspiro[4.4]nonane-1,6-dione |
| SMILES | C=CCNc1nc([C@]2(C)C[C@@]3(C[C@@H](COCC(C)C)OC3=O)C(=O)O2)cs1 |
| InChI | InChI=1S/C19H26N2O5S/c1-5-6-20-17-21-14(10-27-17)18(4)11-19(16(23)26-18)7-13(25-15(19)22)9-24-8-12(2)3/h5,10,12-13H,1,6-9,11H2,2-4H3,(H,20,21)/t13-,18-,19+/m0/s1 |
| InChIKey | RZFJFXKWEQFWGW-FASAQXTFSA-N |
| XLogP | 2.88 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|