About 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane
1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 71404677) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane.
Molecular Properties
| Compound Name | 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
| PubChem CID | 71404677 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=C(C)C1CCC(C)(CC)C(C(=C)C)C1 |
| InChI | InChI=1S/C15H26/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h13-14H,2,4,7-10H2,1,3,5-6H3 |
| InChIKey | ISQNMVFLBCGJAN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane?
The IUPAC name of 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane (CID 71404677) is 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane.
What is the SMILES notation for 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane?
The canonical SMILES for 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane is C=C(C)C1CCC(C)(CC)C(C(=C)C)C1.
What is the InChIKey of 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane?
The InChIKey is ISQNMVFLBCGJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h13-14H,2,4,7-10H2,1,3,5-6H3.
What are the key properties of 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane?
1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane has a molecular weight of 206.37 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane is sourced from PubChem (CID 71404677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).