About dioctan-2-yl pentanedioate
dioctan-2-yl pentanedioate (PubChem CID 71404705) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is dioctan-2-yl pentanedioate.
Molecular Properties
| Compound Name | dioctan-2-yl pentanedioate |
| PubChem CID | 71404705 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | dioctan-2-yl pentanedioate |
| SMILES | CCCCCCC(C)OC(=O)CCCC(=O)OC(C)CCCCCC |
| InChI | InChI=1S/C21H40O4/c1-5-7-9-11-14-18(3)24-20(22)16-13-17-21(23)25-19(4)15-12-10-8-6-2/h18-19H,5-17H2,1-4H3 |
| InChIKey | NLRRFBDZLUBGSA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioctan-2-yl pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctan-2-yl pentanedioate?
The IUPAC name of dioctan-2-yl pentanedioate (CID 71404705) is dioctan-2-yl pentanedioate.
What is the SMILES notation for dioctan-2-yl pentanedioate?
The canonical SMILES for dioctan-2-yl pentanedioate is CCCCCCC(C)OC(=O)CCCC(=O)OC(C)CCCCCC.
What is the InChIKey of dioctan-2-yl pentanedioate?
The InChIKey is NLRRFBDZLUBGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4/c1-5-7-9-11-14-18(3)24-20(22)16-13-17-21(23)25-19(4)15-12-10-8-6-2/h18-19H,5-17H2,1-4H3.
What are the key properties of dioctan-2-yl pentanedioate?
dioctan-2-yl pentanedioate has a molecular weight of 356.55 g/mol, XLogP of 5.96, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioctan-2-yl pentanedioate is sourced from PubChem (CID 71404705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).