About [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate
[[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate (PubChem CID 71404745) has the molecular formula C6H8N4O3
and a molecular weight of 184.16 g/mol. Its IUPAC name is [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate |
| PubChem CID | 71404745 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C(C#N)C(=O)NC |
| InChI | InChI=1S/C6H8N4O3/c1-8-5(11)4(3-7)10-13-6(12)9-2/h1-2H3,(H,8,11)(H,9,12) |
| InChIKey | GYLZLORQJAJXIC-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate?
The IUPAC name of [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate (CID 71404745) is [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate.
What is the SMILES notation for [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate?
The canonical SMILES for [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate is CNC(=O)ON=C(C#N)C(=O)NC.
What is the InChIKey of [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate?
The InChIKey is GYLZLORQJAJXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O3/c1-8-5(11)4(3-7)10-13-6(12)9-2/h1-2H3,(H,8,11)(H,9,12).
What are the key properties of [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate?
[[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate has a molecular weight of 184.16 g/mol, XLogP of -1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-cyano-2-(methylamino)-2-oxoethylidene]amino] N-methylcarbamate is sourced from PubChem (CID 71404745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).