C7H2F14O — CID 71404768
1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptan-1-ol (PubChem CID 71404768) has the molecular formula C7H2F14O and a molecular weight of 368.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptan-1-ol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptan-1-ol |
|---|---|
| PubChem CID | 71404768 |
| Molecular Formula | C7H2F14O |
| Molecular Weight | 368.06 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptan-1-ol |
| SMILES | OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H2F14O/c8-1(9)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)22/h1,22H |
| InChIKey | LTXPBIMCWINHOI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.06 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|