About (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid
(2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid (PubChem CID 71405902) has the molecular formula C12H17Cl2N2O5PS2
and a molecular weight of 435.29 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid |
| PubChem CID | 71405902 |
| Molecular Formula | C12H17Cl2N2O5PS2 |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid |
| SMILES | CCOP(=S)(OCC)Oc1nc(SC[C@H](N)C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N2O5PS2/c1-3-19-22(23,20-4-2)21-10-7(13)5-8(14)11(16-10)24-6-9(15)12(17)18/h5,9H,3-4,6,15H2,1-2H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | VIISYIPKZIMBJQ-VIFPVBQESA-N |
| XLogP | 3.57 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid?
The IUPAC name of (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid (CID 71405902) is (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid?
The canonical SMILES for (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid is CCOP(=S)(OCC)Oc1nc(SC[C@H](N)C(=O)O)c(Cl)cc1Cl.
What is the InChIKey of (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid?
The InChIKey is VIISYIPKZIMBJQ-VIFPVBQESA-N. The full InChI is InChI=1S/C12H17Cl2N2O5PS2/c1-3-19-22(23,20-4-2)21-10-7(13)5-8(14)11(16-10)24-6-9(15)12(17)18/h5,9H,3-4,6,15H2,1-2H3,(H,17,18)/t9-/m0/s1.
What are the key properties of (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid?
(2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid has a molecular weight of 435.29 g/mol, XLogP of 3.57, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphinothioyloxy-2-pyridinyl)sulfanyl]propanoic acid is sourced from PubChem (CID 71405902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).