C14H12F4OS — CID 71406143
2-[2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]thiophene (PubChem CID 71406143) has the molecular formula C14H12F4OS and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]thiophene.
| Compound Name | 2-[2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]thiophene |
|---|---|
| PubChem CID | 71406143 |
| Molecular Formula | C14H12F4OS |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-[2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]phenyl]thiophene |
| SMILES | CC(C)(C)Oc1c(F)c(F)c(-c2cccs2)c(F)c1F |
| InChI | InChI=1S/C14H12F4OS/c1-14(2,3)19-13-11(17)9(15)8(10(16)12(13)18)7-5-4-6-20-7/h4-6H,1-3H3 |
| InChIKey | LFVIXGPVPKVDEO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|