About 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione
7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione (PubChem CID 71406144) has the molecular formula C11H7NO4
and a molecular weight of 217.18 g/mol. Its IUPAC name is 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione.
Molecular Properties
| Compound Name | 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione |
| PubChem CID | 71406144 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione |
| SMILES | CC1=NC(=O)c2cc3c(cc2C1=O)OCO3 |
| InChI | InChI=1S/C11H7NO4/c1-5-10(13)6-2-8-9(16-4-15-8)3-7(6)11(14)12-5/h2-3H,4H2,1H3 |
| InChIKey | JXXSCFBCGALVQL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione?
The IUPAC name of 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione (CID 71406144) is 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione.
What is the SMILES notation for 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione?
The canonical SMILES for 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione is CC1=NC(=O)c2cc3c(cc2C1=O)OCO3.
What is the InChIKey of 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione?
The InChIKey is JXXSCFBCGALVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO4/c1-5-10(13)6-2-8-9(16-4-15-8)3-7(6)11(14)12-5/h2-3H,4H2,1H3.
What are the key properties of 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione?
7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione has a molecular weight of 217.18 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-[1,3]dioxolo[4,5-g]isoquinoline-5,8-dione is sourced from PubChem (CID 71406144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).