About tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one
tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one (PubChem CID 71406170) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one.
Molecular Properties
| Compound Name | tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one |
| PubChem CID | 71406170 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one |
| SMILES | O=C1CC2CCC1C1=C2CCCC1 |
| InChI | InChI=1S/C12H16O/c13-12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h8,11H,1-7H2 |
| InChIKey | IQWNLONYRKCDHE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one?
The IUPAC name of tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one (CID 71406170) is tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one.
What is the SMILES notation for tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one?
The canonical SMILES for tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one is O=C1CC2CCC1C1=C2CCCC1.
What is the InChIKey of tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one?
The InChIKey is IQWNLONYRKCDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12-7-8-5-6-11(12)10-4-2-1-3-9(8)10/h8,11H,1-7H2.
What are the key properties of tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one?
tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one has a molecular weight of 176.26 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.2.02,7]dodec-2(7)-en-9-one is sourced from PubChem (CID 71406170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).