C19H25N5 — CID 71406599
2,6-bis[(3,4,5-trimethylpyrazol-1-yl)methyl]pyridine (PubChem CID 71406599) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2,6-bis[(3,4,5-trimethylpyrazol-1-yl)methyl]pyridine.
| Compound Name | 2,6-bis[(3,4,5-trimethylpyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 71406599 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2,6-bis[(3,4,5-trimethylpyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1nn(Cc2cccc(Cn3nc(C)c(C)c3C)n2)c(C)c1C |
| InChI | InChI=1S/C19H25N5/c1-12-14(3)21-23(16(12)5)10-18-8-7-9-19(20-18)11-24-17(6)13(2)15(4)22-24/h7-9H,10-11H2,1-6H3 |
| InChIKey | WHTPDNOIVPSQOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |