About palladium;tritert-butylphosphane
palladium;tritert-butylphosphane (PubChem CID 71406666) has the molecular formula C12H27PPd
and a molecular weight of 308.74 g/mol. Its IUPAC name is palladium;tritert-butylphosphane.
Molecular Properties
| Compound Name | palladium;tritert-butylphosphane |
| PubChem CID | 71406666 |
| Molecular Formula | C12H27PPd |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | palladium;tritert-butylphosphane |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Pd] |
| InChI | InChI=1S/C12H27P.Pd/c1-10(2,3)13(11(4,5)6)12(7,8)9;/h1-9H3; |
| InChIKey | LOJAQAYKWFMKMR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;tritert-butylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;tritert-butylphosphane?
The IUPAC name of palladium;tritert-butylphosphane (CID 71406666) is palladium;tritert-butylphosphane.
What is the SMILES notation for palladium;tritert-butylphosphane?
The canonical SMILES for palladium;tritert-butylphosphane is CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Pd].
What is the InChIKey of palladium;tritert-butylphosphane?
The InChIKey is LOJAQAYKWFMKMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.Pd/c1-10(2,3)13(11(4,5)6)12(7,8)9;/h1-9H3;.
What are the key properties of palladium;tritert-butylphosphane?
palladium;tritert-butylphosphane has a molecular weight of 308.74 g/mol, XLogP of 4.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;tritert-butylphosphane is sourced from PubChem (CID 71406666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).