About 4-(1,2,2-trifluoroethenoxy)but-1-ene
4-(1,2,2-trifluoroethenoxy)but-1-ene (PubChem CID 71406867) has the molecular formula C6H7F3O
and a molecular weight of 152.11 g/mol. Its IUPAC name is 4-(1,2,2-trifluoroethenoxy)but-1-ene.
Molecular Properties
| Compound Name | 4-(1,2,2-trifluoroethenoxy)but-1-ene |
| PubChem CID | 71406867 |
| Molecular Formula | C6H7F3O |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4-(1,2,2-trifluoroethenoxy)but-1-ene |
| SMILES | C=CCCOC(F)=C(F)F |
| InChI | InChI=1S/C6H7F3O/c1-2-3-4-10-6(9)5(7)8/h2H,1,3-4H2 |
| InChIKey | DFHPOIODNKJREU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2,2-trifluoroethenoxy)but-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,2-trifluoroethenoxy)but-1-ene?
The IUPAC name of 4-(1,2,2-trifluoroethenoxy)but-1-ene (CID 71406867) is 4-(1,2,2-trifluoroethenoxy)but-1-ene.
What is the SMILES notation for 4-(1,2,2-trifluoroethenoxy)but-1-ene?
The canonical SMILES for 4-(1,2,2-trifluoroethenoxy)but-1-ene is C=CCCOC(F)=C(F)F.
What is the InChIKey of 4-(1,2,2-trifluoroethenoxy)but-1-ene?
The InChIKey is DFHPOIODNKJREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3O/c1-2-3-4-10-6(9)5(7)8/h2H,1,3-4H2.
What are the key properties of 4-(1,2,2-trifluoroethenoxy)but-1-ene?
4-(1,2,2-trifluoroethenoxy)but-1-ene has a molecular weight of 152.11 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,2-trifluoroethenoxy)but-1-ene is sourced from PubChem (CID 71406867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).