About 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol
4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 71407207) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol |
| PubChem CID | 71407207 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(CCO)C(C)(C)CC(O)C1 |
| InChI | InChI=1S/C11H20O2/c1-8-6-9(13)7-11(2,3)10(8)4-5-12/h9,12-13H,4-7H2,1-3H3 |
| InChIKey | IVKNQEUNEKZPBL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol?
The IUPAC name of 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol (CID 71407207) is 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol.
What is the SMILES notation for 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol?
The canonical SMILES for 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol is CC1=C(CCO)C(C)(C)CC(O)C1.
What is the InChIKey of 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol?
The InChIKey is IVKNQEUNEKZPBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-8-6-9(13)7-11(2,3)10(8)4-5-12/h9,12-13H,4-7H2,1-3H3.
What are the key properties of 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol?
4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol has a molecular weight of 184.28 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-ol is sourced from PubChem (CID 71407207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).