C15H26O4 — CID 71407309
5,9,9-triethoxynona-2,6-dienal (PubChem CID 71407309) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 5,9,9-triethoxynona-2,6-dienal.
| Compound Name | 5,9,9-triethoxynona-2,6-dienal |
|---|---|
| PubChem CID | 71407309 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5,9,9-triethoxynona-2,6-dienal |
| SMILES | CCOC(C=CCC(OCC)OCC)CC=CC=O |
| InChI | InChI=1S/C15H26O4/c1-4-17-14(10-7-8-13-16)11-9-12-15(18-5-2)19-6-3/h7-9,11,13-15H,4-6,10,12H2,1-3H3 |
| InChIKey | JJJLPNQBDHQEFZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|