C7H11NO2 — CID 71407578
(5S,8R)-5-hydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 71407578) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (5S,8R)-5-hydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5S,8R)-5-hydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 71407578 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (5S,8R)-5-hydroxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1CC[C@H]2CC[C@H](O)N12 |
| InChI | InChI=1S/C7H11NO2/c9-6-3-1-5-2-4-7(10)8(5)6/h5-6,9H,1-4H2/t5-,6+/m1/s1 |
| InChIKey | DVXYURHYLCRZHR-RITPCOANSA-N |
| XLogP | 0.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |