C22H27N3O4 — CID 71407704
tert-butyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 71407704) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 71407704 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl N-[2-[(2S)-2-(naphthalen-2-ylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCC[C@H]1C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,3)29-21(28)23-14-19(26)25-12-6-9-18(25)20(27)24-17-11-10-15-7-4-5-8-16(15)13-17/h4-5,7-8,10-11,13,18H,6,9,12,14H2,1-3H3,(H,23,28)(H,24,27)/t18-/m0/s1 |
| InChIKey | LKLKKYFJNXNWNC-SFHVURJKSA-N |
| XLogP | 3.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |