C12H14O — CID 71407755
(4bR,8aS)-4b,5,6,7,8,8a-hexahydrobiphenylen-1-ol (PubChem CID 71407755) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (4bR,8aS)-4b,5,6,7,8,8a-hexahydrobiphenylen-1-ol.
| Compound Name | (4bR,8aS)-4b,5,6,7,8,8a-hexahydrobiphenylen-1-ol |
|---|---|
| PubChem CID | 71407755 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (4bR,8aS)-4b,5,6,7,8,8a-hexahydrobiphenylen-1-ol |
| SMILES | Oc1cccc2c1[C@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C12H14O/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h3,6-9,13H,1-2,4-5H2/t8-,9+/m1/s1 |
| InChIKey | LHKMENBIIKZZPO-BDAKNGLRSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |