C11H14O5 — CID 71408272
(1R,2S)-1-(7-methoxy-1,3-benzodioxol-5-yl)propane-1,2-diol (PubChem CID 71408272) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (1R,2S)-1-(7-methoxy-1,3-benzodioxol-5-yl)propane-1,2-diol.
| Compound Name | (1R,2S)-1-(7-methoxy-1,3-benzodioxol-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 71408272 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1R,2S)-1-(7-methoxy-1,3-benzodioxol-5-yl)propane-1,2-diol |
| SMILES | COc1cc([C@@H](O)[C@H](C)O)cc2c1OCO2 |
| InChI | InChI=1S/C11H14O5/c1-6(12)10(13)7-3-8(14-2)11-9(4-7)15-5-16-11/h3-4,6,10,12-13H,5H2,1-2H3/t6-,10-/m0/s1 |
| InChIKey | SISNFIMJZCCPLD-WKEGUHRASA-N |
| XLogP | 0.84 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |