C20H17FO2 — CID 71408280
(8R,9R)-2-fluoro-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol (PubChem CID 71408280) has the molecular formula C20H17FO2 and a molecular weight of 308.35 g/mol. Its IUPAC name is (8R,9R)-2-fluoro-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol.
| Compound Name | (8R,9R)-2-fluoro-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol |
|---|---|
| PubChem CID | 71408280 |
| Molecular Formula | C20H17FO2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (8R,9R)-2-fluoro-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol |
| SMILES | Cc1c2c(c(C)c3c1ccc1ccc(F)cc13)C=C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C20H17FO2/c1-10-15-7-8-17(22)20(23)19(15)11(2)14-6-4-12-3-5-13(21)9-16(12)18(10)14/h3-9,17,20,22-23H,1-2H3/t17-,20+/m1/s1 |
| InChIKey | DPVLMEIZACVXMT-XLIONFOSSA-N |
| XLogP | 4.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|