C8H10N4O2 — CID 71408324
(2S,3S)-2,3-dimethoxy-1,2,3,4-tetrahydropyrazine-5,6-dicarbonitrile (PubChem CID 71408324) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethoxy-1,2,3,4-tetrahydropyrazine-5,6-dicarbonitrile.
| Compound Name | (2S,3S)-2,3-dimethoxy-1,2,3,4-tetrahydropyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 71408324 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (2S,3S)-2,3-dimethoxy-1,2,3,4-tetrahydropyrazine-5,6-dicarbonitrile |
| SMILES | CO[C@@H]1NC(C#N)=C(C#N)N[C@H]1OC |
| InChI | InChI=1S/C8H10N4O2/c1-13-7-8(14-2)12-6(4-10)5(3-9)11-7/h7-8,11-12H,1-2H3/t7-,8-/m0/s1 |
| InChIKey | ONCRMAFGISNNON-YUMQZZPRSA-N |
| XLogP | -0.62 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |