About 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole
8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole (PubChem CID 71408712) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole.
Molecular Properties
| Compound Name | 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole |
| PubChem CID | 71408712 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole |
| SMILES | Cc1cccc2c3c([nH]c12)CCc1cncnc1-3 |
| InChI | InChI=1S/C15H13N3/c1-9-3-2-4-11-13-12(18-14(9)11)6-5-10-7-16-8-17-15(10)13/h2-4,7-8,18H,5-6H2,1H3 |
| InChIKey | JTOOHDKRSLVNSY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole?
The IUPAC name of 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole (CID 71408712) is 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole.
What is the SMILES notation for 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole?
The canonical SMILES for 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole is Cc1cccc2c3c([nH]c12)CCc1cncnc1-3.
What is the InChIKey of 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole?
The InChIKey is JTOOHDKRSLVNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c1-9-3-2-4-11-13-12(18-14(9)11)6-5-10-7-16-8-17-15(10)13/h2-4,7-8,18H,5-6H2,1H3.
What are the key properties of 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole?
8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole has a molecular weight of 235.29 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6,7-dihydro-5H-pyrimido[5,4-c]carbazole is sourced from PubChem (CID 71408712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).