About (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene
(1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene (PubChem CID 71408761) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene.
Analyze (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene?
The IUPAC name of (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene (CID 71408761) is (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene.
What is the SMILES notation for (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene?
The canonical SMILES for (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene is CC1(C)[C@H]2C=CC=CC=C[C@@H]21.
What is the InChIKey of (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene?
The InChIKey is KEJMCDIIYHPJOW-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H14/c1-11(2)9-7-5-3-4-6-8-10(9)11/h3-10H,1-2H3/t9-,10-/m0/s1.
What are the key properties of (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene?
(1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene has a molecular weight of 146.23 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-9,9-dimethylbicyclo[6.1.0]nona-2,4,6-triene is sourced from PubChem (CID 71408761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).