About 2-chloroethyl 2-quinolin-8-yloxyacetate
2-chloroethyl 2-quinolin-8-yloxyacetate (PubChem CID 71408832) has the molecular formula C13H12ClNO3
and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-chloroethyl 2-quinolin-8-yloxyacetate.
Molecular Properties
| Compound Name | 2-chloroethyl 2-quinolin-8-yloxyacetate |
| PubChem CID | 71408832 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-chloroethyl 2-quinolin-8-yloxyacetate |
| SMILES | O=C(COc1cccc2cccnc12)OCCCl |
| InChI | InChI=1S/C13H12ClNO3/c14-6-8-17-12(16)9-18-11-5-1-3-10-4-2-7-15-13(10)11/h1-5,7H,6,8-9H2 |
| InChIKey | DOQQOSVWPSENKG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl 2-quinolin-8-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl 2-quinolin-8-yloxyacetate?
The IUPAC name of 2-chloroethyl 2-quinolin-8-yloxyacetate (CID 71408832) is 2-chloroethyl 2-quinolin-8-yloxyacetate.
What is the SMILES notation for 2-chloroethyl 2-quinolin-8-yloxyacetate?
The canonical SMILES for 2-chloroethyl 2-quinolin-8-yloxyacetate is O=C(COc1cccc2cccnc12)OCCCl.
What is the InChIKey of 2-chloroethyl 2-quinolin-8-yloxyacetate?
The InChIKey is DOQQOSVWPSENKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO3/c14-6-8-17-12(16)9-18-11-5-1-3-10-4-2-7-15-13(10)11/h1-5,7H,6,8-9H2.
What are the key properties of 2-chloroethyl 2-quinolin-8-yloxyacetate?
2-chloroethyl 2-quinolin-8-yloxyacetate has a molecular weight of 265.70 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl 2-quinolin-8-yloxyacetate is sourced from PubChem (CID 71408832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).