About 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide
2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide (PubChem CID 71408967) has the molecular formula C14H22IN
and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide.
Molecular Properties
| Compound Name | 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide |
| PubChem CID | 71408967 |
| Molecular Formula | C14H22IN |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide |
| SMILES | CCCC[N+]1(C)CCc2ccccc2C1.[I-] |
| InChI | InChI=1S/C14H22N.HI/c1-3-4-10-15(2)11-9-13-7-5-6-8-14(13)12-15;/h5-8H,3-4,9-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QIKANJJGJUYFQR-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide?
The IUPAC name of 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide (CID 71408967) is 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide.
What is the SMILES notation for 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide?
The canonical SMILES for 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide is CCCC[N+]1(C)CCc2ccccc2C1.[I-].
What is the InChIKey of 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide?
The InChIKey is QIKANJJGJUYFQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22N.HI/c1-3-4-10-15(2)11-9-13-7-5-6-8-14(13)12-15;/h5-8H,3-4,9-12H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide?
2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide has a molecular weight of 331.24 g/mol, XLogP of -0.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium iodide is sourced from PubChem (CID 71408967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).