C24H34N5O+ — CID 7140935
(4-tert-butylphenyl)methyl-[(1-cyclohexyltetrazol-5-yl)methyl]-(furan-2-ylmethyl)azanium (PubChem CID 7140935) has the molecular formula C24H34N5O+ and a molecular weight of 408.57 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl-[(1-cyclohexyltetrazol-5-yl)methyl]-(furan-2-ylmethyl)azanium.
| Compound Name | (4-tert-butylphenyl)methyl-[(1-cyclohexyltetrazol-5-yl)methyl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7140935 |
| Molecular Formula | C24H34N5O+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (4-tert-butylphenyl)methyl-[(1-cyclohexyltetrazol-5-yl)methyl]-(furan-2-ylmethyl)azanium |
| SMILES | CC(C)(C)c1ccc(C[NH+](Cc2ccco2)Cc2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H33N5O/c1-24(2,3)20-13-11-19(12-14-20)16-28(17-22-10-7-15-30-22)18-23-25-26-27-29(23)21-8-5-4-6-9-21/h7,10-15,21H,4-6,8-9,16-18H2,1-3H3/p+1 |
| InChIKey | NAZQYSWIQDGHPW-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |