About 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione
3-butyl-5-methyl-1,3,4-thiadiazole-2-thione (PubChem CID 71409541) has the molecular formula C7H12N2S2
and a molecular weight of 188.32 g/mol. Its IUPAC name is 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione |
| PubChem CID | 71409541 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCn1nc(C)sc1=S |
| InChI | InChI=1S/C7H12N2S2/c1-3-4-5-9-7(10)11-6(2)8-9/h3-5H2,1-2H3 |
| InChIKey | SDLCSHSZWAGQIS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione?
The IUPAC name of 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione (CID 71409541) is 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione is CCCCn1nc(C)sc1=S.
What is the InChIKey of 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione?
The InChIKey is SDLCSHSZWAGQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2S2/c1-3-4-5-9-7(10)11-6(2)8-9/h3-5H2,1-2H3.
What are the key properties of 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione?
3-butyl-5-methyl-1,3,4-thiadiazole-2-thione has a molecular weight of 188.32 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-5-methyl-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 71409541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).