About 9,10-dimethyl-1,2-dihydroanthracene
9,10-dimethyl-1,2-dihydroanthracene (PubChem CID 71409601) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 9,10-dimethyl-1,2-dihydroanthracene.
Molecular Properties
| Compound Name | 9,10-dimethyl-1,2-dihydroanthracene |
| PubChem CID | 71409601 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 9,10-dimethyl-1,2-dihydroanthracene |
| SMILES | Cc1c2c(c(C)c3ccccc13)CCC=C2 |
| InChI | InChI=1S/C16H16/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-5,7-9H,6,10H2,1-2H3 |
| InChIKey | AZDAIASRFCVNQS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9,10-dimethyl-1,2-dihydroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethyl-1,2-dihydroanthracene?
The IUPAC name of 9,10-dimethyl-1,2-dihydroanthracene (CID 71409601) is 9,10-dimethyl-1,2-dihydroanthracene.
What is the SMILES notation for 9,10-dimethyl-1,2-dihydroanthracene?
The canonical SMILES for 9,10-dimethyl-1,2-dihydroanthracene is Cc1c2c(c(C)c3ccccc13)CCC=C2.
What is the InChIKey of 9,10-dimethyl-1,2-dihydroanthracene?
The InChIKey is AZDAIASRFCVNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-5,7-9H,6,10H2,1-2H3.
What are the key properties of 9,10-dimethyl-1,2-dihydroanthracene?
9,10-dimethyl-1,2-dihydroanthracene has a molecular weight of 208.30 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethyl-1,2-dihydroanthracene is sourced from PubChem (CID 71409601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).