C20H25FN5+ — CID 7140971
benzyl-[(1-tert-butyltetrazol-5-yl)methyl]-[(4-fluorophenyl)methyl]azanium (PubChem CID 7140971) has the molecular formula C20H25FN5+ and a molecular weight of 354.45 g/mol. Its IUPAC name is benzyl-[(1-tert-butyltetrazol-5-yl)methyl]-[(4-fluorophenyl)methyl]azanium.
| Compound Name | benzyl-[(1-tert-butyltetrazol-5-yl)methyl]-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 7140971 |
| Molecular Formula | C20H25FN5+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | benzyl-[(1-tert-butyltetrazol-5-yl)methyl]-[(4-fluorophenyl)methyl]azanium |
| SMILES | CC(C)(C)n1nnnc1C[NH+](Cc1ccccc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN5/c1-20(2,3)26-19(22-23-24-26)15-25(13-16-7-5-4-6-8-16)14-17-9-11-18(21)12-10-17/h4-12H,13-15H2,1-3H3/p+1 |
| InChIKey | FGVZOXXIDDDAPD-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |